CAS 2788-56-9 appears in our catalog under these names: 4-Nitrophenyl 1-thio-beta-d-glucopyranoside, 95%, (2R,3S,4S,5R,6S)–2–(hydroxymethyl)–6–((4–nitrophenyl)thio)tetrahydro–2H–pyran–3,4,5–triol, 4-Nitrophenyl b-D-thioglucopyranoside, 4-Nitrophenyl b-D-thioglucopyranoside, 50 mg, 4-Nitrophenyl b-D-thioglucopyranoside, 100 mg. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 100mg, 250mg, 50mg, 1g, 500mg, 1000mg.
2-(hydroxymethyl)-6-(4-nitrophenyl)sulfanyloxane-3,4,5-triol (CAS 2788-56-9) is a chemical compound with the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. IUPAC name: 2-(hydroxymethyl)-6-(4-nitrophenyl)sulfanyloxane-3,4,5-triol. InChIKey: IXFOBQXJWRLXMD-UHFFFAOYSA-N.
| Molecular formula | C12H15NO7S |
|---|---|
| Molecular weight | 317.32 g/mol |
| IUPAC name | 2-(hydroxymethyl)-6-(4-nitrophenyl)sulfanyloxane-3,4,5-triol |
| InChIKey | IXFOBQXJWRLXMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])SC2C(C(C(C(O2)CO)O)O)O |
Computed by PubChem (NCBI)