CAS 62414-75-9 is the registry number for 2,3,4-Tri-o-acetyl-alpha-d-arabinopyranosylisothiocyanate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R,4R,5S,6S)-4,5-diacetyloxy-6-isothiocyanatooxan-3-yl] acetate (CAS 62414-75-9) is a chemical compound with the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. IUPAC name: [(3R,4R,5S,6S)-4,5-diacetyloxy-6-isothiocyanatooxan-3-yl] acetate. InChIKey: RCHZRAFPHKCWRI-WYUUTHIRSA-N.
| Molecular formula | C12H15NO7S |
|---|---|
| Molecular weight | 317.32 g/mol |
| IUPAC name | [(3R,4R,5S,6S)-4,5-diacetyloxy-6-isothiocyanatooxan-3-yl] acetate |
| InChIKey | RCHZRAFPHKCWRI-WYUUTHIRSA-N |
| SMILES | CC(=O)O[C@@H]1CO[C@@H]([C@H]([C@@H]1OC(=O)C)OC(=O)C)N=C=S |
Computed by PubChem (NCBI)