CAS 27896-84-0 appears in our catalog under these names: 6–Nitrobenzimidazole Nitrate, 5-Nitrobenzimidazole Nitrate, >98.0%(T), 1H-Benzimidazole, 6-nitro-, nitrate (1:1), ≥98%, ≥98%, 5-Nitro-1H-benzo[d]imidazole nitrate, 98%+,RG. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 250g, 5g.
Nitric acid;6-nitro-1H-benzimidazole (CAS 27896-84-0) is a chemical compound with the molecular formula C7H6N4O5 and a molecular weight of 226.15 g/mol. IUPAC name: nitric acid;6-nitro-1H-benzimidazole. InChIKey: ZUZQXHSOEZUAIS-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O5 |
|---|---|
| Molecular weight | 226.15 g/mol |
| IUPAC name | nitric acid;6-nitro-1H-benzimidazole |
| InChIKey | ZUZQXHSOEZUAIS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])NC=N2.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)