CAS 2900-63-2 appears in our catalog under these names: 3,5-Dinitrobenzhydrazide, min. 95 %, 2 g, 3,5-Dinitrobenzhydrazide, min. 95 %, 1 g, 3,5-Dinitrobenzohydrazide, 95%, 3,5-Dinitrobenzhydrazide, 3,5-Dinitrobenzohydrazide, 98%, 98%. Offered by: Roth, Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 2g, 1g, 250mg, 2000mg, 1000mg, 5000mg, 10000mg, 100mg.
3,5-dinitrobenzohydrazide (CAS 2900-63-2) is a chemical compound with the molecular formula C7H6N4O5 and a molecular weight of 226.15 g/mol. IUPAC name: 3,5-dinitrobenzohydrazide. InChIKey: IJVPILVRNBBRSO-UHFFFAOYSA-N.
| Molecular formula | C7H6N4O5 |
|---|---|
| Molecular weight | 226.15 g/mol |
| IUPAC name | 3,5-dinitrobenzohydrazide |
| InChIKey | IJVPILVRNBBRSO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)NN |
Computed by PubChem (NCBI)