CAS 27912-07-8 is the registry number for trans-1,2,3,4,4a,10,11,11a-Octahydro-5H-dibenzo(a,d)cyclohepten-5-one. Offered by: TRC. Available pack sizes: 250mg.
(3R,8S)-tricyclo[9.4.0.03,8]pentadeca-1(15),11,13-trien-2-one (CAS 27912-07-8) is a chemical compound with the molecular formula C15H18O and a molecular weight of 214.30 g/mol. IUPAC name: (3R,8S)-tricyclo[9.4.0.03,8]pentadeca-1(15),11,13-trien-2-one. InChIKey: DERKBZMWBHNMBF-GXTWGEPZSA-N.
| Molecular formula | C15H18O |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | (3R,8S)-tricyclo[9.4.0.03,8]pentadeca-1(15),11,13-trien-2-one |
| InChIKey | DERKBZMWBHNMBF-GXTWGEPZSA-N |
| SMILES | C1CC[C@@H]2[C@@H](C1)CCC3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)