Products 87605-93-4
CAS 87605-93-4 is the registry number for Furanoeudesma 1,3-diene. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg.
(4aS,8aS)-3,5,8a-trimethyl-4a,9-dihydro-4H-benzo[f][1]benzofuran (CAS 87605-93-4) is a chemical compound with the molecular formula C15H18O and a molecular weight of 214.30 g/mol. IUPAC name: (4aS,8aS)-3,5,8a-trimethyl-4a,9-dihydro-4H-benzo[f][1]benzofuran. InChIKey: AUSAHAHDEVYCOC-DZGCQCFKSA-N.
| Molecular formula | C15H18O |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | (4aS,8aS)-3,5,8a-trimethyl-4a,9-dihydro-4H-benzo[f][1]benzofuran |
| InChIKey | AUSAHAHDEVYCOC-DZGCQCFKSA-N |
| SMILES | CC1=CC=C[C@]2([C@H]1CC3=C(C2)OC=C3C)C |
Computed by PubChem (NCBI)