CAS 2221-88-7 is the registry number for Lindestrene. Offered by: Chemat Brand. Available pack sizes: on request.
(4aS,8aS)-3,8a-dimethyl-5-methylidene-4,4a,6,9-tetrahydrobenzo[f][1]benzofuran (CAS 2221-88-7) is a chemical compound with the molecular formula C15H18O and a molecular weight of 214.30 g/mol. IUPAC name: (4aS,8aS)-3,8a-dimethyl-5-methylidene-4,4a,6,9-tetrahydrobenzo[f][1]benzofuran. InChIKey: BZQURGSQMBBPRU-DZGCQCFKSA-N.
| Molecular formula | C15H18O |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | (4aS,8aS)-3,8a-dimethyl-5-methylidene-4,4a,6,9-tetrahydrobenzo[f][1]benzofuran |
| InChIKey | BZQURGSQMBBPRU-DZGCQCFKSA-N |
| SMILES | CC1=COC2=C1C[C@H]3C(=C)CC=C[C@@]3(C2)C |
Computed by PubChem (NCBI)