Products 2791313-09-0
CAS 2791313-09-0 is the registry number for 1-(5-Bromo-6-(methylthio)pyridin-3-yl)-2,2,2-trifluoroethan-1-ol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5-bromo-6-methylsulfanyl-3-pyridinyl)-2,2,2-trifluoroethanol (CAS 2791313-09-0) is a chemical compound with the molecular formula C8H7BrF3NOS and a molecular weight of 302.11 g/mol. IUPAC name: 1-(5-bromo-6-methylsulfanyl-3-pyridinyl)-2,2,2-trifluoroethanol. InChIKey: VKLJEKPNRDGVKP-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3NOS |
|---|---|
| Molecular weight | 302.11 g/mol |
| IUPAC name | 1-(5-bromo-6-methylsulfanyl-3-pyridinyl)-2,2,2-trifluoroethanol |
| InChIKey | VKLJEKPNRDGVKP-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=N1)C(C(F)(F)F)O)Br |
Computed by PubChem (NCBI)