CAS 2966063-86-3 is the registry number for (2-Bromo-5-(trifluoromethyl)phenyl)(imino)(methyl)-l6-sulfanone, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2-bromo-5-(trifluoromethyl)phenyl]-imino-methyl-oxo-lambda6-sulfane (CAS 2966063-86-3) is a chemical compound with the molecular formula C8H7BrF3NOS and a molecular weight of 302.11 g/mol. IUPAC name: [2-bromo-5-(trifluoromethyl)phenyl]-imino-methyl-oxo-lambda6-sulfane. InChIKey: PZMREYSVGXIYLY-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3NOS |
|---|---|
| Molecular weight | 302.11 g/mol |
| IUPAC name | [2-bromo-5-(trifluoromethyl)phenyl]-imino-methyl-oxo-lambda6-sulfane |
| InChIKey | PZMREYSVGXIYLY-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=C(C=CC(=C1)C(F)(F)F)Br |
Computed by PubChem (NCBI)