CAS 27920-90-7 is the registry number for (7R)–7–(4–carboxybutanamido)cephalosporanic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
(7R)-7-(4-carboxybutanamido)cephalosporanic acid is a cephalosporin. It is functionally related to a cephalosporanic acid. It is a conjugate acid of a (7R)-7-(4-carboxylatobutanamido)cephalosporanate.
Source: ChEBI
| Molecular formula | C15H18N2O8S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | (6R,7R)-3-(acetyloxymethyl)-7-(4-carboxybutanoylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | IXUSDMGLUJZNFO-BXUZGUMPSA-N |
| SMILES | CC(=O)OCC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)CCCC(=O)O)SC1)C(=O)O |
Computed by PubChem (NCBI)