CAS 28542-31-6 appears in our catalog under these names: 2-Thiouridine 2’,3’,5’-Triacetate, 2',3',5'–Tri–O–acetyl–2–thiouridine, 2',3',5'-Tri-O-acetyl-2-thiouridine, 99.27%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 1g, 250mg, 500mg, 10mg, 5mg, 10 mg, 5 mg.
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate (CAS 28542-31-6) is a chemical compound with the molecular formula C15H18N2O8S and a molecular weight of 386.4 g/mol. IUPAC name: [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate. InChIKey: YKDNCFTUUKOENT-FMKGYKFTSA-N.
| Molecular formula | C15H18N2O8S |
|---|---|
| Molecular weight | 386.4 g/mol |
| IUPAC name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-(4-oxo-2-sulfanylidenepyrimidin-1-yl)oxolan-2-yl]methyl acetate |
| InChIKey | YKDNCFTUUKOENT-FMKGYKFTSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=CC(=O)NC2=S)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)