CAS 2792143-53-2 is the registry number for ((2R,4R)-4-Fluoro-5-oxopyrrolidin-2-yl)methyl 4-methylbenzenesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,4R)-4-fluoro-5-oxopyrrolidin-2-yl]methyl 4-methylbenzenesulfonate (CAS 2792143-53-2) is a chemical compound with the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. IUPAC name: [(2R,4R)-4-fluoro-5-oxopyrrolidin-2-yl]methyl 4-methylbenzenesulfonate. InChIKey: ABQORYMWRIEMTE-MWLCHTKSSA-N.
| Molecular formula | C12H14FNO4S |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | [(2R,4R)-4-fluoro-5-oxopyrrolidin-2-yl]methyl 4-methylbenzenesulfonate |
| InChIKey | ABQORYMWRIEMTE-MWLCHTKSSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2C[C@H](C(=O)N2)F |
Computed by PubChem (NCBI)