CAS 311785-51-0 is the registry number for 4-Fluoro-3-(piperidine-1-sulfonyl)-benzoic acid, 95%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
4-fluoro-3-piperidin-1-ylsulfonylbenzoic acid (CAS 311785-51-0) is a chemical compound with the molecular formula C12H14FNO4S and a molecular weight of 287.31 g/mol. IUPAC name: 4-fluoro-3-piperidin-1-ylsulfonylbenzoic acid. InChIKey: MOVTXEIZLBYCGT-UHFFFAOYSA-N.
| Molecular formula | C12H14FNO4S |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 4-fluoro-3-piperidin-1-ylsulfonylbenzoic acid |
| InChIKey | MOVTXEIZLBYCGT-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=C(C=CC(=C2)C(=O)O)F |
Computed by PubChem (NCBI)