CAS 2792155-01-0 is the registry number for 2-Bromo-1-((1R,4R)-1-methyl-2-oxabicyclo[2.2.1]heptan-4-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-[(1R,4R)-1-methyl-2-oxabicyclo[2.2.1]heptan-4-yl]ethanone (CAS 2792155-01-0) is a chemical compound with the molecular formula C9H13BrO2 and a molecular weight of 233.10 g/mol. IUPAC name: 2-bromo-1-[(1R,4R)-1-methyl-2-oxabicyclo[2.2.1]heptan-4-yl]ethanone. InChIKey: UTCLPPJAMHXMLO-RKDXNWHRSA-N.
| Molecular formula | C9H13BrO2 |
|---|---|
| Molecular weight | 233.10 g/mol |
| IUPAC name | 2-bromo-1-[(1R,4R)-1-methyl-2-oxabicyclo[2.2.1]heptan-4-yl]ethanone |
| InChIKey | UTCLPPJAMHXMLO-RKDXNWHRSA-N |
| SMILES | C[C@@]12CC[C@@](C1)(CO2)C(=O)CBr |
Computed by PubChem (NCBI)