Products 3031763-51-3
CAS 3031763-51-3 is the registry number for Ethyl (R)-4-Bromo-3-cyclohexenecarboxylate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 5g.
Ethyl (1R)-4-bromocyclohex-3-ene-1-carboxylate (CAS 3031763-51-3) is a chemical compound with the molecular formula C9H13BrO2 and a molecular weight of 233.10 g/mol. IUPAC name: ethyl (1R)-4-bromocyclohex-3-ene-1-carboxylate. InChIKey: JMGPAKUOUAFRNQ-ZETCQYMHSA-N.
| Molecular formula | C9H13BrO2 |
|---|---|
| Molecular weight | 233.10 g/mol |
| IUPAC name | ethyl (1R)-4-bromocyclohex-3-ene-1-carboxylate |
| InChIKey | JMGPAKUOUAFRNQ-ZETCQYMHSA-N |
| SMILES | CCOC(=O)[C@@H]1CCC(=CC1)Br |
Computed by PubChem (NCBI)