Products 2794934-81-7
CAS 2794934-81-7 is the registry number for 1-(3,5-Bis(difluoromethyl)phenyl)ethan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3,5-bis(difluoromethyl)phenyl]ethanamine (CAS 2794934-81-7) is a chemical compound with the molecular formula C10H11F4N and a molecular weight of 221.19 g/mol. IUPAC name: 1-[3,5-bis(difluoromethyl)phenyl]ethanamine. InChIKey: FGAUIBBASNOKJE-UHFFFAOYSA-N.
| Molecular formula | C10H11F4N |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 1-[3,5-bis(difluoromethyl)phenyl]ethanamine |
| InChIKey | FGAUIBBASNOKJE-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)C(F)F)C(F)F)N |
Computed by PubChem (NCBI)