Products 473732-66-0
CAS 473732-66-0 is the registry number for 1-[3-Fluoro-4-(trifluoromethyl)phenyl]propylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-[3-fluoro-4-(trifluoromethyl)phenyl]propan-1-amine (CAS 473732-66-0) is a chemical compound with the molecular formula C10H11F4N and a molecular weight of 221.19 g/mol. IUPAC name: 1-[3-fluoro-4-(trifluoromethyl)phenyl]propan-1-amine. InChIKey: LPQFPLJRYJOIMC-UHFFFAOYSA-N.
| Molecular formula | C10H11F4N |
|---|---|
| Molecular weight | 221.19 g/mol |
| IUPAC name | 1-[3-fluoro-4-(trifluoromethyl)phenyl]propan-1-amine |
| InChIKey | LPQFPLJRYJOIMC-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC(=C(C=C1)C(F)(F)F)F)N |
Computed by PubChem (NCBI)