CAS 2796975-82-9 is the registry number for (R)-Usnic acid Sodium, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
Sodium (9bR)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-1-oxodibenzofuran-3-olate (CAS 2796975-82-9) is a chemical compound with the molecular formula C18H15NaO7 and a molecular weight of 366.3 g/mol. IUPAC name: sodium (9bR)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-1-oxodibenzofuran-3-olate. InChIKey: RIDMFEXHWJXRLI-FERBBOLQSA-M.
| Molecular formula | C18H15NaO7 |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | sodium (9bR)-2,6-diacetyl-7,9-dihydroxy-8,9b-dimethyl-1-oxodibenzofuran-3-olate |
| InChIKey | RIDMFEXHWJXRLI-FERBBOLQSA-M |
| SMILES | CC1=C(C(=C2C(=C1O)[C@@]3(C(=CC(=C(C3=O)C(=O)C)[O-])O2)C)C(=O)C)O.[Na+] |
Computed by PubChem (NCBI)