CAS 2801-32-3 appears in our catalog under these names: 3–Methyl–8–nitroquinoline, 3-Methyl-8-nitroquinoline, 95%, 3-Methyl-8-nitroquinoline 95%, 3-Methyl-8-nitroquinoline, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-methyl-8-nitroquinoline (CAS 2801-32-3) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 3-methyl-8-nitroquinoline. InChIKey: DWHMTTROZUHZMC-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 3-methyl-8-nitroquinoline |
| InChIKey | DWHMTTROZUHZMC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=CC=C2)[N+](=O)[O-])N=C1 |
Computed by PubChem (NCBI)