Products 2803284-08-2
CAS 2803284-08-2 is the registry number for ((2R,4S)-4-Fluoro-1,2-dimethylpyrrolidin-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,4S)-4-fluoro-1,2-dimethylpyrrolidin-2-yl]methanol (CAS 2803284-08-2) is a chemical compound with the molecular formula C7H14FNO and a molecular weight of 147.19 g/mol. IUPAC name: [(2R,4S)-4-fluoro-1,2-dimethylpyrrolidin-2-yl]methanol. InChIKey: GITFXLOGDAALFR-NKWVEPMBSA-N.
| Molecular formula | C7H14FNO |
|---|---|
| Molecular weight | 147.19 g/mol |
| IUPAC name | [(2R,4S)-4-fluoro-1,2-dimethylpyrrolidin-2-yl]methanol |
| InChIKey | GITFXLOGDAALFR-NKWVEPMBSA-N |
| SMILES | C[C@@]1(C[C@@H](CN1C)F)CO |
Computed by PubChem (NCBI)