Products 2803477-11-2
CAS 2803477-11-2 is the registry number for N-(4-Aminophenyl)-N-cyclopropyl-2-(dimethylamino)acetamide, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
N-(4-aminophenyl)-N-cyclopropyl-2-(dimethylamino)acetamide (CAS 2803477-11-2) is a chemical compound with the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. IUPAC name: N-(4-aminophenyl)-N-cyclopropyl-2-(dimethylamino)acetamide. InChIKey: QHGZYQWOJDONJF-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | N-(4-aminophenyl)-N-cyclopropyl-2-(dimethylamino)acetamide |
| InChIKey | QHGZYQWOJDONJF-UHFFFAOYSA-N |
| SMILES | CN(C)CC(=O)N(C1CC1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)