Products 2803859-30-3
CAS 2803859-30-3 is the registry number for tert-Butyl 5-isopropyl-3-azabicyclo[3.1.1]heptane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 5-propan-2-yl-3-azabicyclo[3.1.1]heptane-1-carboxylate (CAS 2803859-30-3) is a chemical compound with the molecular formula C14H25NO2 and a molecular weight of 239.35 g/mol. IUPAC name: tert-butyl 5-propan-2-yl-3-azabicyclo[3.1.1]heptane-1-carboxylate. InChIKey: SRQIDDRZWOHTFJ-UHFFFAOYSA-N.
| Molecular formula | C14H25NO2 |
|---|---|
| Molecular weight | 239.35 g/mol |
| IUPAC name | tert-butyl 5-propan-2-yl-3-azabicyclo[3.1.1]heptane-1-carboxylate |
| InChIKey | SRQIDDRZWOHTFJ-UHFFFAOYSA-N |
| SMILES | CC(C)C12CC(C1)(CNC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)