CAS 68548-08-3 appears in our catalog under these names: 1,2,2,6,6-Pentamethyl-4-piperidyl methacrylate, 95%, 1,2,2,6,6–Pentamethyl–4–piperidyl methacrylate(stabilizedwithMEHQ), 1,2,2,6,6-Pentamethyl-4-piperidyl Methacrylate (stabilized with MEHQ), >97.0%(GC), 1,2,2,6,6-Pentamethyl-4-piperidyl Methacrylate, 97%, 97%, 1,2,2,6,6-PENTAMETHYL-4-PIPERIDYL METHACRYLATE. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 500g.
(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylprop-2-enoate (CAS 68548-08-3) is a chemical compound with the molecular formula C14H25NO2 and a molecular weight of 239.35 g/mol. IUPAC name: (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylprop-2-enoate. InChIKey: NWPIOULNZLJZHU-UHFFFAOYSA-N.
| Molecular formula | C14H25NO2 |
|---|---|
| Molecular weight | 239.35 g/mol |
| IUPAC name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-methylprop-2-enoate |
| InChIKey | NWPIOULNZLJZHU-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1CC(N(C(C1)(C)C)C)(C)C |
Computed by PubChem (NCBI)