Products 2803861-67-6
CAS 2803861-67-6 is the registry number for 3-Cyclobutylbicyclo[1.1.1]pentan-1-amine Hydrochloride, >97%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
3-cyclobutylbicyclo[1.1.1]pentan-1-amine;hydrochloride (CAS 2803861-67-6) is a chemical compound with the molecular formula C9H16ClN and a molecular weight of 173.68 g/mol. IUPAC name: 3-cyclobutylbicyclo[1.1.1]pentan-1-amine;hydrochloride. InChIKey: YKMNBOOYCKRDRT-UHFFFAOYSA-N.
| Molecular formula | C9H16ClN |
|---|---|
| Molecular weight | 173.68 g/mol |
| IUPAC name | 3-cyclobutylbicyclo[1.1.1]pentan-1-amine;hydrochloride |
| InChIKey | YKMNBOOYCKRDRT-UHFFFAOYSA-N |
| SMILES | C1CC(C1)C23CC(C2)(C3)N.Cl |
Computed by PubChem (NCBI)