Products 2805804-17-3

CAS 2805804-17-3 is the registry number for 2-Methyl-2,5-diazaspiro[3.4]octane dihydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-methyl-2,5-diazaspiro[3.4]octane;dihydrochloride (CAS 2805804-17-3) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: 2-methyl-2,5-diazaspiro[3.4]octane;dihydrochloride. InChIKey: MNECYTPTMHPASN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16Cl2N2
Molecular weight199.12 g/mol
IUPAC name2-methyl-2,5-diazaspiro[3.4]octane;dihydrochloride
InChIKeyMNECYTPTMHPASN-UHFFFAOYSA-N
SMILESCN1CC2(C1)CCCN2.Cl.Cl

Computed by PubChem (NCBI)