Products 2806869-45-2
CAS 2806869-45-2 appears in our catalog under these names: (3S)-1-benzyl-5,5-dimethyl-piperidin-3-amine,dihydrochloride, 97%, 97%, (3S)-1-benzyl-5,5-dimethyl-piperidin-3-amine,dihydrochloride, 97%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(3S)-1-benzyl-5,5-dimethylpiperidin-3-amine;dihydrochloride (CAS 2806869-45-2) is a chemical compound with the molecular formula C14H24Cl2N2 and a molecular weight of 291.3 g/mol. IUPAC name: (3S)-1-benzyl-5,5-dimethylpiperidin-3-amine;dihydrochloride. InChIKey: MLKZLHOPFMWDNS-GXKRWWSZSA-N.
| Molecular formula | C14H24Cl2N2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | (3S)-1-benzyl-5,5-dimethylpiperidin-3-amine;dihydrochloride |
| InChIKey | MLKZLHOPFMWDNS-GXKRWWSZSA-N |
| SMILES | CC1(C[C@@H](CN(C1)CC2=CC=CC=C2)N)C.Cl.Cl |
Computed by PubChem (NCBI)