CAS 2807454-56-2 is the registry number for 2-Bromo-3-chloro-6-fluoro-5-methylbenzoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-bromo-3-chloro-6-fluoro-5-methylbenzoic acid (CAS 2807454-56-2) is a chemical compound with the molecular formula C8H5BrClFO2 and a molecular weight of 267.48 g/mol. IUPAC name: 2-bromo-3-chloro-6-fluoro-5-methylbenzoic acid. InChIKey: OYTCIBQBYFSDQZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClFO2 |
|---|---|
| Molecular weight | 267.48 g/mol |
| IUPAC name | 2-bromo-3-chloro-6-fluoro-5-methylbenzoic acid |
| InChIKey | OYTCIBQBYFSDQZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1F)C(=O)O)Br)Cl |
Computed by PubChem (NCBI)