Products 2807470-89-7
CAS 2807470-89-7 is the registry number for 1-Bromo-2-chloro-4-isopropoxy-3-methylbenzene, ≥99.7%. Offered by: Chemat. Available pack sizes: 1g, 5g.
1-bromo-2-chloro-3-methyl-4-propan-2-yloxybenzene (CAS 2807470-89-7) is a chemical compound with the molecular formula C10H12BrClO and a molecular weight of 263.56 g/mol. IUPAC name: 1-bromo-2-chloro-3-methyl-4-propan-2-yloxybenzene. InChIKey: XNDSYLXDXKPPCN-UHFFFAOYSA-N.
| Molecular formula | C10H12BrClO |
|---|---|
| Molecular weight | 263.56 g/mol |
| IUPAC name | 1-bromo-2-chloro-3-methyl-4-propan-2-yloxybenzene |
| InChIKey | XNDSYLXDXKPPCN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1Cl)Br)OC(C)C |
Computed by PubChem (NCBI)