CAS 28081-54-1 appears in our catalog under these names: (3-Benzyl-4-oxo-3,4-dihydro-phthalazin-1-yl)-acetic acid, 95%, (3-Benzyl-4-oxo-3,4-dihydrophthalazin-1-yl)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg.
2-(3-benzyl-4-oxophthalazin-1-yl)acetic acid (CAS 28081-54-1) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: 2-(3-benzyl-4-oxophthalazin-1-yl)acetic acid. InChIKey: RQPPZGICNYEPHM-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 2-(3-benzyl-4-oxophthalazin-1-yl)acetic acid |
| InChIKey | RQPPZGICNYEPHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C3=CC=CC=C3C(=N2)CC(=O)O |
Computed by PubChem (NCBI)