CAS 2810029-90-2 is the registry number for 8-(1,1-Dioxidothiomorpholino)-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-(1,1-dioxo-1,4-thiazinan-4-yl)-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylic acid (CAS 2810029-90-2) is a chemical compound with the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. IUPAC name: 8-(1,1-dioxo-1,4-thiazinan-4-yl)-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylic acid. InChIKey: JTYYDSFXIDPKPT-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O4S |
|---|---|
| Molecular weight | 311.36 g/mol |
| IUPAC name | 8-(1,1-dioxo-1,4-thiazinan-4-yl)-5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylic acid |
| InChIKey | JTYYDSFXIDPKPT-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2CNCC3=C2N=C(C=C3)C(=O)O |
Computed by PubChem (NCBI)