CAS 733030-45-0 appears in our catalog under these names: 3-(5-Dimethylsulfamoyl-1-methyl-1h-benzoimidazol-2-yl)-propionic acid, 95%, 3-(5-(N,N-Dimethylsulfamoyl)-1-methyl-1H-benzo(d)imidazol-2-yl)propanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoic acid (CAS 733030-45-0) is a chemical compound with the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. IUPAC name: 3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoic acid. InChIKey: TYQLURJFXMSFSW-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O4S |
|---|---|
| Molecular weight | 311.36 g/mol |
| IUPAC name | 3-[5-(dimethylsulfamoyl)-1-methylbenzimidazol-2-yl]propanoic acid |
| InChIKey | TYQLURJFXMSFSW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)S(=O)(=O)N(C)C)N=C1CCC(=O)O |
Computed by PubChem (NCBI)