CAS 793678-98-5 is the registry number for 3-(1-Propyl-5-sulfamoyl-1H-1,3-benzodiazol-2-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(1-propyl-5-sulfamoylbenzimidazol-2-yl)propanoic acid (CAS 793678-98-5) is a chemical compound with the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. IUPAC name: 3-(1-propyl-5-sulfamoylbenzimidazol-2-yl)propanoic acid. InChIKey: ODHYOZKMIDLFGM-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O4S |
|---|---|
| Molecular weight | 311.36 g/mol |
| IUPAC name | 3-(1-propyl-5-sulfamoylbenzimidazol-2-yl)propanoic acid |
| InChIKey | ODHYOZKMIDLFGM-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C=C(C=C2)S(=O)(=O)N)N=C1CCC(=O)O |
Computed by PubChem (NCBI)