Products 2810876-21-0
CAS 2810876-21-0 is the registry number for 3-(4-bromo-3-methyl-1H-indazol-1-yl)piperidine-2,6-dione, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
3-(4-bromo-3-methylindazol-1-yl)piperidine-2,6-dione (CAS 2810876-21-0) is a chemical compound with the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. IUPAC name: 3-(4-bromo-3-methylindazol-1-yl)piperidine-2,6-dione. InChIKey: ZLUVATRLNAPIMZ-UHFFFAOYSA-N.
| Molecular formula | C13H12BrN3O2 |
|---|---|
| Molecular weight | 322.16 g/mol |
| IUPAC name | 3-(4-bromo-3-methylindazol-1-yl)piperidine-2,6-dione |
| InChIKey | ZLUVATRLNAPIMZ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=CC=C2)Br)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)