CAS 2888607-41-6 appears in our catalog under these names: 3-(5-Bromo-3-methyl-1H-indazol-1-yl)piperidine-2,6-dione, 95%, 95%, 3-(5-Bromo-3-methyl-1H-indazol-1-yl)piperidine-2,6-dione, 98%, 3-(5-Bromo-3-methyl-1H-indazol-1-yl)piperidine-2,6-dione, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
3-(5-bromo-3-methylindazol-1-yl)piperidine-2,6-dione (CAS 2888607-41-6) is a chemical compound with the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. IUPAC name: 3-(5-bromo-3-methylindazol-1-yl)piperidine-2,6-dione. InChIKey: FVGWSLGHAUFBFH-UHFFFAOYSA-N.
| Molecular formula | C13H12BrN3O2 |
|---|---|
| Molecular weight | 322.16 g/mol |
| IUPAC name | 3-(5-bromo-3-methylindazol-1-yl)piperidine-2,6-dione |
| InChIKey | FVGWSLGHAUFBFH-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C=C(C=C2)Br)C3CCC(=O)NC3=O |
Computed by PubChem (NCBI)