CAS 1001567-66-3 is the registry number for N-(4-Acetylphenyl)-4-bromo-1-methyl-1H-pyrazole-5-carboxamide. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
N-(4-acetylphenyl)-4-bromo-1-methylpyrazole-5-carboxamide (CAS 1001567-66-3) is a chemical compound with the molecular formula C13H12BrN3O2 and a molecular weight of 322.16 g/mol. IUPAC name: N-(4-acetylphenyl)-4-bromo-1-methylpyrazole-5-carboxamide. InChIKey: ZCHRPQFFIVNUHK-UHFFFAOYSA-N.
| Molecular formula | C13H12BrN3O2 |
|---|---|
| Molecular weight | 322.16 g/mol |
| IUPAC name | N-(4-acetylphenyl)-4-bromo-1-methylpyrazole-5-carboxamide |
| InChIKey | ZCHRPQFFIVNUHK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)C2=C(C=NN2C)Br |
Computed by PubChem (NCBI)