CAS 28140-93-4 is the registry number for Cyamemazine Impurity 8. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
10H-phenothiazine-3-carbonitrile (CAS 28140-93-4) is a chemical compound with the molecular formula C13H8N2S and a molecular weight of 224.28 g/mol. IUPAC name: 10H-phenothiazine-3-carbonitrile. InChIKey: PMWFJTLZEZSXEO-UHFFFAOYSA-N.
| Molecular formula | C13H8N2S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | 10H-phenothiazine-3-carbonitrile |
| InChIKey | PMWFJTLZEZSXEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=C(C=C3)C#N |
Computed by PubChem (NCBI)