CAS 38642-74-9 appears in our catalog under these names: 2–Cyano–phenothiazine, 10H-Phenothiazine-2-carbonitrile, >98.0%(GC), 2-Cyanophenothiazine, 2-Cyano-phenothiazine 98%, 2-Cyanophenothiazine, 99.60%. Offered by: GLPBio, TCI, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 100g, 25g, 5g, 10g, 50g, 5 g, 25 g, 10 g.
10H-phenothiazine-2-carbonitrile (CAS 38642-74-9) is a chemical compound with the molecular formula C13H8N2S and a molecular weight of 224.28 g/mol. IUPAC name: 10H-phenothiazine-2-carbonitrile. InChIKey: XZSIGWOVDPSPMG-UHFFFAOYSA-N.
| Molecular formula | C13H8N2S |
|---|---|
| Molecular weight | 224.28 g/mol |
| IUPAC name | 10H-phenothiazine-2-carbonitrile |
| InChIKey | XZSIGWOVDPSPMG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=CC(=C3)C#N |
Computed by PubChem (NCBI)