CAS 2814523-39-0 is the registry number for Methyl 6-amino-5-bromo-2-chloronicotinate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-amino-5-bromo-2-chloropyridine-3-carboxylate (CAS 2814523-39-0) is a chemical compound with the molecular formula C7H6BrClN2O2 and a molecular weight of 265.49 g/mol. IUPAC name: methyl 6-amino-5-bromo-2-chloropyridine-3-carboxylate. InChIKey: XDBUZZVSZHINJU-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClN2O2 |
|---|---|
| Molecular weight | 265.49 g/mol |
| IUPAC name | methyl 6-amino-5-bromo-2-chloropyridine-3-carboxylate |
| InChIKey | XDBUZZVSZHINJU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(N=C1Cl)N)Br |
Computed by PubChem (NCBI)