CAS 577691-68-0 is the registry number for Methyl 6-amino-5-bromo-3-chloropyridine-2-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 6-amino-5-bromo-3-chloropyridine-2-carboxylate (CAS 577691-68-0) is a chemical compound with the molecular formula C7H6BrClN2O2 and a molecular weight of 265.49 g/mol. IUPAC name: methyl 6-amino-5-bromo-3-chloropyridine-2-carboxylate. InChIKey: WRVXVTUGOFOAIW-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClN2O2 |
|---|---|
| Molecular weight | 265.49 g/mol |
| IUPAC name | methyl 6-amino-5-bromo-3-chloropyridine-2-carboxylate |
| InChIKey | WRVXVTUGOFOAIW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C=C1Cl)Br)N |
Computed by PubChem (NCBI)