Products 2816820-15-0
CAS 2816820-15-0 is the registry number for (2R,3R)-1-(tert-Butoxycarbonyl)-3-(4-fluorophenyl)azetidine-2-carboxylic acid, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R,3R)-3-(4-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid (CAS 2816820-15-0) is a chemical compound with the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. IUPAC name: (2R,3R)-3-(4-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid. InChIKey: JAUASKZOOQLCQE-NWDGAFQWSA-N.
| Molecular formula | C15H18FNO4 |
|---|---|
| Molecular weight | 295.31 g/mol |
| IUPAC name | (2R,3R)-3-(4-fluorophenyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-2-carboxylic acid |
| InChIKey | JAUASKZOOQLCQE-NWDGAFQWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)