Products 2817635-83-7
CAS 2817635-83-7 is the registry number for tert-Butyl 6'-chloro-2',3'-dihydro-1'H-spiro[cyclopropane-1,4'-quinoline]-1'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 6-chlorospiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-carboxylate (CAS 2817635-83-7) is a chemical compound with the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. IUPAC name: tert-butyl 6-chlorospiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-carboxylate. InChIKey: KNTJGROGZMGZQM-UHFFFAOYSA-N.
| Molecular formula | C16H20ClNO2 |
|---|---|
| Molecular weight | 293.79 g/mol |
| IUPAC name | tert-butyl 6-chlorospiro[2,3-dihydroquinoline-4,1'-cyclopropane]-1-carboxylate |
| InChIKey | KNTJGROGZMGZQM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC2)C3=C1C=CC(=C3)Cl |
Computed by PubChem (NCBI)