CAS 2570172-38-0 is the registry number for (1R)-1-{3-[(4-Methoxyphenyl)methoxy]phenyl}ethanamine hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(1R)-1-[3-[(4-methoxyphenyl)methoxy]phenyl]ethanamine;hydrochloride (CAS 2570172-38-0) is a chemical compound with the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. IUPAC name: (1R)-1-[3-[(4-methoxyphenyl)methoxy]phenyl]ethanamine;hydrochloride. InChIKey: YESUSACZXGAGPT-UTONKHPSSA-N.
| Molecular formula | C16H20ClNO2 |
|---|---|
| Molecular weight | 293.79 g/mol |
| IUPAC name | (1R)-1-[3-[(4-methoxyphenyl)methoxy]phenyl]ethanamine;hydrochloride |
| InChIKey | YESUSACZXGAGPT-UTONKHPSSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)OCC2=CC=C(C=C2)OC)N.Cl |
Computed by PubChem (NCBI)