Products 1644667-07-1
CAS 1644667-07-1 is the registry number for tert-Butyl 4-(chloromethyl)-5,7-dimethyl-1H-indole-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-(chloromethyl)-5,7-dimethylindole-1-carboxylate (CAS 1644667-07-1) is a chemical compound with the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. IUPAC name: tert-butyl 4-(chloromethyl)-5,7-dimethylindole-1-carboxylate. InChIKey: PTYRWVDBFWJKEE-UHFFFAOYSA-N.
| Molecular formula | C16H20ClNO2 |
|---|---|
| Molecular weight | 293.79 g/mol |
| IUPAC name | tert-butyl 4-(chloromethyl)-5,7-dimethylindole-1-carboxylate |
| InChIKey | PTYRWVDBFWJKEE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1CCl)C=CN2C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)