CAS 28180-44-1 is the registry number for 2-(3,5-Difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (CAS 28180-44-1) is a chemical compound with the molecular formula C9H4F8O and a molecular weight of 280.11 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol. InChIKey: VQEPBBDGMVJTNB-UHFFFAOYSA-N.
| Molecular formula | C9H4F8O |
|---|---|
| Molecular weight | 280.11 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| InChIKey | VQEPBBDGMVJTNB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(C(F)(F)F)(C(F)(F)F)O |
Computed by PubChem (NCBI)