Products 745030-84-6
CAS 745030-84-6 is the registry number for 1-(Difluoromethoxy)-3,5-bis(trifluoromethyl)benzene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene (CAS 745030-84-6) is a chemical compound with the molecular formula C9H4F8O and a molecular weight of 280.11 g/mol. IUPAC name: 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene. InChIKey: MHKACPMSUQVVBH-UHFFFAOYSA-N.
| Molecular formula | C9H4F8O |
|---|---|
| Molecular weight | 280.11 g/mol |
| IUPAC name | 1-(difluoromethoxy)-3,5-bis(trifluoromethyl)benzene |
| InChIKey | MHKACPMSUQVVBH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)OC(F)F)C(F)(F)F |
Computed by PubChem (NCBI)