Products 28188-60-5

CAS 28188-60-5 is the registry number for 4-ISOPROPYLPHENYL METHYL CARBONATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Methyl (4-propan-2-ylphenyl) carbonate (CAS 28188-60-5) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: methyl (4-propan-2-ylphenyl) carbonate. InChIKey: UOSHSOCAFAHKNH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O3
Molecular weight194.23 g/mol
IUPAC namemethyl (4-propan-2-ylphenyl) carbonate
InChIKeyUOSHSOCAFAHKNH-UHFFFAOYSA-N
SMILESCC(C)C1=CC=C(C=C1)OC(=O)OC

Computed by PubChem (NCBI)