CAS 2818959-27-0 is the registry number for 8-Chloro-7-iodoimidazo[1,2-a]pyridine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-chloro-7-iodoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 2818959-27-0) is a chemical compound with the molecular formula C8H4ClIN2O2 and a molecular weight of 322.49 g/mol. IUPAC name: 8-chloro-7-iodoimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: YTULANZNHPPVQI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClIN2O2 |
|---|---|
| Molecular weight | 322.49 g/mol |
| IUPAC name | 8-chloro-7-iodoimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | YTULANZNHPPVQI-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C(=C1I)Cl)C(=O)O |
Computed by PubChem (NCBI)