CAS 2940949-36-8 is the registry number for 5-chloro-8-iodo-imidazo[1,2-a]pyridine-3-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
5-chloro-8-iodoimidazo[1,2-a]pyridine-3-carboxylic acid (CAS 2940949-36-8) is a chemical compound with the molecular formula C8H4ClIN2O2 and a molecular weight of 322.49 g/mol. IUPAC name: 5-chloro-8-iodoimidazo[1,2-a]pyridine-3-carboxylic acid. InChIKey: MJOYLDNHYZRFKI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClIN2O2 |
|---|---|
| Molecular weight | 322.49 g/mol |
| IUPAC name | 5-chloro-8-iodoimidazo[1,2-a]pyridine-3-carboxylic acid |
| InChIKey | MJOYLDNHYZRFKI-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC=C(N2C(=C1)Cl)C(=O)O)I |
Computed by PubChem (NCBI)