CAS 2818961-65-6 appears in our catalog under these names: 3,3-Dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indolin-2-one, 98%, (3,3-DIMETHYL-2-OXOINDOLIN-5-YL)BORONIC ACID PINACOL ESTER, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg, 500mg.
3,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-2-one (CAS 2818961-65-6) is a chemical compound with the molecular formula C16H22BNO3 and a molecular weight of 287.2 g/mol. IUPAC name: 3,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-2-one. InChIKey: LXMBGAJEMKGVDR-UHFFFAOYSA-N.
| Molecular formula | C16H22BNO3 |
|---|---|
| Molecular weight | 287.2 g/mol |
| IUPAC name | 3,3-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-2-one |
| InChIKey | LXMBGAJEMKGVDR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)NC(=O)C3(C)C |
Computed by PubChem (NCBI)