Products 2819999-35-2

CAS 2819999-35-2 is the registry number for 1-(2-Aminopropyl)pyrrolidine-3-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-(2-aminopropyl)pyrrolidine-3-carboxylic acid (CAS 2819999-35-2) is a chemical compound with the molecular formula C8H16N2O2 and a molecular weight of 172.22 g/mol. IUPAC name: 1-(2-aminopropyl)pyrrolidine-3-carboxylic acid. InChIKey: DRRPBURBOLJFLS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H16N2O2
Molecular weight172.22 g/mol
IUPAC name1-(2-aminopropyl)pyrrolidine-3-carboxylic acid
InChIKeyDRRPBURBOLJFLS-UHFFFAOYSA-N
SMILESCC(CN1CCC(C1)C(=O)O)N

Computed by PubChem (NCBI)